C52H96N4O6 — CID 170694681
3-butylheptyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(3-nitro-2-pyridinyl)amino]propyl]amino]octanoate (PubChem CID 170694681) has the molecular formula C52H96N4O6 and a molecular weight of 873.36 g/mol. Its IUPAC name is 3-butylheptyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(3-nitro-2-pyridinyl)amino]propyl]amino]octanoate.
| Compound Name | 3-butylheptyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(3-nitro-2-pyridinyl)amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 170694681 |
| Molecular Formula | C52H96N4O6 |
| Molecular Weight | 873.36 g/mol |
| Exact Mass | 872.73 |
| IUPAC Name | 3-butylheptyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(3-nitro-2-pyridinyl)amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OCCC(CCCC)CCCC)CCCNc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C52H96N4O6/c1-5-9-13-15-19-25-35-48(36-26-20-16-14-10-6-2)62-51(58)39-28-22-18-24-30-44-55(45-32-42-54-52-49(56(59)60)37-31-41-53-52)43-29-23-17-21-27-38-50(57)61-46-40-47(33-11-7-3)34-12-8-4/h31,37,41,47-48H,5-30,32-36,38-40,42-46H2,1-4H3,(H,53,54) |
| InChIKey | JBEWAUMVJNICBO-UHFFFAOYSA-N |
| XLogP | 15.12 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.36 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|