C55H99N5O6 — CID 166565555
undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(1-methyl-5-nitroindazol-3-yl)amino]propyl]amino]octanoate (PubChem CID 166565555) has the molecular formula C55H99N5O6 and a molecular weight of 926.43 g/mol. Its IUPAC name is undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(1-methyl-5-nitroindazol-3-yl)amino]propyl]amino]octanoate.
| Compound Name | undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(1-methyl-5-nitroindazol-3-yl)amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 166565555 |
| Molecular Formula | C55H99N5O6 |
| Molecular Weight | 926.43 g/mol |
| Exact Mass | 925.76 |
| IUPAC Name | undecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(1-methyl-5-nitroindazol-3-yl)amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNc1nn(C)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C55H99N5O6/c1-6-10-13-16-21-28-36-49(9-4)65-53(61)39-31-24-19-26-33-44-59(46-35-43-56-55-51-47-48(60(63)64)41-42-52(51)58(5)57-55)45-34-27-20-25-32-40-54(62)66-50(37-29-22-17-14-11-7-2)38-30-23-18-15-12-8-3/h41-42,47,49-50H,6-40,43-46H2,1-5H3,(H,56,57) |
| InChIKey | QNGALZKJNYXIKZ-UHFFFAOYSA-N |
| XLogP | 15.75 |
| TPSA | 128.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.43 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|