C52H95FN6O4 — CID 166565585
undecan-3-yl 8-[3-[(2-fluoro-7H-purin-6-yl)amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 166565585) has the molecular formula C52H95FN6O4 and a molecular weight of 887.37 g/mol. Its IUPAC name is undecan-3-yl 8-[3-[(2-fluoro-7H-purin-6-yl)amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | undecan-3-yl 8-[3-[(2-fluoro-7H-purin-6-yl)amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 166565585 |
| Molecular Formula | C52H95FN6O4 |
| Molecular Weight | 887.37 g/mol |
| Exact Mass | 886.74 |
| IUPAC Name | undecan-3-yl 8-[3-[(2-fluoro-7H-purin-6-yl)amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNc1nc(F)nc2nc[nH]c12 |
| InChI | InChI=1S/C52H95FN6O4/c1-5-9-12-15-20-27-35-45(8-4)62-47(60)38-30-23-18-25-32-41-59(43-34-40-54-50-49-51(56-44-55-49)58-52(53)57-50)42-33-26-19-24-31-39-48(61)63-46(36-28-21-16-13-10-6-2)37-29-22-17-14-11-7-3/h44-46H,5-43H2,1-4H3,(H2,54,55,56,57,58) |
| InChIKey | GVHAXNXWLZSILQ-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.37 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|