C40H74N4O4 — CID 168924434
heptadecan-9-yl 8-[8-oxooctyl-[3-[(6-oxo-1H-pyrimidin-4-yl)amino]propyl]amino]octanoate (PubChem CID 168924434) has the molecular formula C40H74N4O4 and a molecular weight of 675.06 g/mol. Its IUPAC name is heptadecan-9-yl 8-[8-oxooctyl-[3-[(6-oxo-1H-pyrimidin-4-yl)amino]propyl]amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[8-oxooctyl-[3-[(6-oxo-1H-pyrimidin-4-yl)amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 168924434 |
| Molecular Formula | C40H74N4O4 |
| Molecular Weight | 675.06 g/mol |
| Exact Mass | 674.57 |
| IUPAC Name | heptadecan-9-yl 8-[8-oxooctyl-[3-[(6-oxo-1H-pyrimidin-4-yl)amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC=O)CCCNc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C40H74N4O4/c1-3-5-7-9-14-20-27-37(28-21-15-10-8-6-4-2)48-40(47)29-22-16-13-18-24-32-44(31-23-17-11-12-19-25-34-45)33-26-30-41-38-35-39(46)43-36-42-38/h34-37H,3-33H2,1-2H3,(H2,41,42,43,46) |
| InChIKey | MSZPHTUUPWAEIV-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.06 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|