C39H78N6O3 — CID 170754828
heptadecan-9-yl 8-[3-[[(Z)-[amino-(2-methylidenehydrazinyl)methylidene]amino]methylamino]propyl-(8-oxooctyl)amino]octanoate (PubChem CID 170754828) has the molecular formula C39H78N6O3 and a molecular weight of 679.09 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-[[(Z)-[amino-(2-methylidenehydrazinyl)methylidene]amino]methylamino]propyl-(8-oxooctyl)amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[3-[[(Z)-[amino-(2-methylidenehydrazinyl)methylidene]amino]methylamino]propyl-(8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 170754828 |
| Molecular Formula | C39H78N6O3 |
| Molecular Weight | 679.09 g/mol |
| Exact Mass | 678.61 |
| IUPAC Name | heptadecan-9-yl 8-[3-[[(Z)-[amino-(2-methylidenehydrazinyl)methylidene]amino]methylamino]propyl-(8-oxooctyl)amino]octanoate |
| SMILES | C=NN/C(N)=N\CNCCCN(CCCCCCCC=O)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C39H78N6O3/c1-4-6-8-10-15-21-28-37(29-22-16-11-9-7-5-2)48-38(47)30-23-17-14-19-25-33-45(32-24-18-12-13-20-26-35-46)34-27-31-42-36-43-39(40)44-41-3/h35,37,42H,3-34,36H2,1-2H3,(H3,40,43,44) |
| InChIKey | AUWXDPASVMQGBT-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.09 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|