C28H55NO4 — CID 166923339
decan-2-yl 8-[2-hydroxyethyl(8-oxooctyl)amino]octanoate (PubChem CID 166923339) has the molecular formula C28H55NO4 and a molecular weight of 469.75 g/mol. Its IUPAC name is decan-2-yl 8-[2-hydroxyethyl(8-oxooctyl)amino]octanoate.
| Compound Name | decan-2-yl 8-[2-hydroxyethyl(8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 166923339 |
| Molecular Formula | C28H55NO4 |
| Molecular Weight | 469.75 g/mol |
| Exact Mass | 469.41 |
| IUPAC Name | decan-2-yl 8-[2-hydroxyethyl(8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCC(C)OC(=O)CCCCCCCN(CCO)CCCCCCCC=O |
| InChI | InChI=1S/C28H55NO4/c1-3-4-5-6-10-15-20-27(2)33-28(32)21-16-11-9-13-18-23-29(24-26-31)22-17-12-7-8-14-19-25-30/h25,27,31H,3-24,26H2,1-2H3 |
| InChIKey | JBZRVYGMNAUDJE-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.75 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|