C40H78N2O3S — CID 156710173
heptadecan-9-yl 8-[3-(cyclopropylmethylsulfanylamino)propyl-(8-oxooctyl)amino]octanoate (PubChem CID 156710173) has the molecular formula C40H78N2O3S and a molecular weight of 667.14 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-(cyclopropylmethylsulfanylamino)propyl-(8-oxooctyl)amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[3-(cyclopropylmethylsulfanylamino)propyl-(8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 156710173 |
| Molecular Formula | C40H78N2O3S |
| Molecular Weight | 667.14 g/mol |
| Exact Mass | 666.57 |
| IUPAC Name | heptadecan-9-yl 8-[3-(cyclopropylmethylsulfanylamino)propyl-(8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC=O)CCCNSCC1CC1 |
| InChI | InChI=1S/C40H78N2O3S/c1-3-5-7-9-14-20-27-39(28-21-15-10-8-6-4-2)45-40(44)29-22-16-13-18-24-34-42(33-23-17-11-12-19-25-36-43)35-26-32-41-46-37-38-30-31-38/h36,38-39,41H,3-35,37H2,1-2H3 |
| InChIKey | CYUKXCXZXWVEAN-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.14 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|