About hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate
hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate (PubChem CID 155278414) has the molecular formula C43H83NO5
and a molecular weight of 694.14 g/mol. Its IUPAC name is hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate.
Molecular Properties
| Compound Name | hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
| PubChem CID | 155278414 |
| Molecular Formula | C43H83NO5 |
| Molecular Weight | 694.14 g/mol |
| Exact Mass | 693.63 |
| IUPAC Name | hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCC)OC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)OC(CCCCC)C1CC1 |
| InChI | InChI=1S/C43H83NO5/c1-4-7-10-12-16-23-29-40(28-22-15-11-8-5-2)48-42(46)31-24-17-13-19-26-35-44(37-38-45)36-27-20-14-18-25-32-43(47)49-41(39-33-34-39)30-21-9-6-3/h39-41,45H,4-38H2,1-3H3 |
| InChIKey | XSPMGXRXXKIGBF-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 694.14 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate?
The IUPAC name of hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate (CID 155278414) is hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate.
What is the SMILES notation for hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate?
The canonical SMILES for hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate is CCCCCCCCC(CCCCCCC)OC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)OC(CCCCC)C1CC1.
What is the InChIKey of hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate?
The InChIKey is XSPMGXRXXKIGBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H83NO5/c1-4-7-10-12-16-23-29-40(28-22-15-11-8-5-2)48-42(46)31-24-17-13-19-26-35-44(37-38-45)36-27-20-14-18-25-32-43(47)49-41(39-33-34-39)30-21-9-6-3/h39-41,45H,4-38H2,1-3H3.
What are the key properties of hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate?
hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate has a molecular weight of 694.14 g/mol, XLogP of 11.89, 38 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecan-8-yl 8-[[8-(1-cyclopropylhexoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate is sourced from PubChem (CID 155278414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).