About undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate
undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate (PubChem CID 129232754) has the molecular formula C41H79NO5
and a molecular weight of 666.09 g/mol. Its IUPAC name is undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate.
Molecular Properties
| Compound Name | undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
| PubChem CID | 129232754 |
| Molecular Formula | C41H79NO5 |
| Molecular Weight | 666.09 g/mol |
| Exact Mass | 665.60 |
| IUPAC Name | undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)OC(CCCCCCCC)C1CC1 |
| InChI | InChI=1S/C41H79NO5/c1-4-7-9-11-15-21-27-38(6-3)46-40(44)29-23-17-13-19-25-33-42(35-36-43)34-26-20-14-18-24-30-41(45)47-39(37-31-32-37)28-22-16-12-10-8-5-2/h37-39,43H,4-36H2,1-3H3 |
| InChIKey | AXLNVQVGXKXISC-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 666.09 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate?
The IUPAC name of undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate (CID 129232754) is undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate.
What is the SMILES notation for undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate?
The canonical SMILES for undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate is CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)OC(CCCCCCCC)C1CC1.
What is the InChIKey of undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate?
The InChIKey is AXLNVQVGXKXISC-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H79NO5/c1-4-7-9-11-15-21-27-38(6-3)46-40(44)29-23-17-13-19-25-33-42(35-36-43)34-26-20-14-18-24-30-41(45)47-39(37-31-32-37)28-22-16-12-10-8-5-2/h37-39,43H,4-36H2,1-3H3.
What are the key properties of undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate?
undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate has a molecular weight of 666.09 g/mol, XLogP of 11.11, 36 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for undecan-3-yl 8-[[8-(1-cyclopropylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate is sourced from PubChem (CID 129232754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).