C45H91NO5 — CID 146464163
undecan-3-yl 8-[8,8-dioctoxyoctyl(2-hydroxyethyl)amino]octanoate (PubChem CID 146464163) has the molecular formula C45H91NO5 and a molecular weight of 726.22 g/mol. Its IUPAC name is undecan-3-yl 8-[8,8-dioctoxyoctyl(2-hydroxyethyl)amino]octanoate.
| Compound Name | undecan-3-yl 8-[8,8-dioctoxyoctyl(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 146464163 |
| Molecular Formula | C45H91NO5 |
| Molecular Weight | 726.22 g/mol |
| Exact Mass | 725.69 |
| IUPAC Name | undecan-3-yl 8-[8,8-dioctoxyoctyl(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCOC(CCCCCCCN(CCO)CCCCCCCC(=O)OC(CC)CCCCCCCC)OCCCCCCCC |
| InChI | InChI=1S/C45H91NO5/c1-5-9-12-15-20-27-34-43(8-4)51-44(48)35-28-21-18-23-30-37-46(39-40-47)38-31-24-19-22-29-36-45(49-41-32-25-16-13-10-6-2)50-42-33-26-17-14-11-7-3/h43,45,47H,5-42H2,1-4H3 |
| InChIKey | FATIVSYTTLAXCN-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.22 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|