C48H97NO5 — CID 171840807
nonyl 9-[2-hydroxyethyl-(9-oxo-9-undecan-3-yloxynonyl)amino]nonanoate;octane (PubChem CID 171840807) has the molecular formula C48H97NO5 and a molecular weight of 768.31 g/mol. Its IUPAC name is nonyl 9-[2-hydroxyethyl-(9-oxo-9-undecan-3-yloxynonyl)amino]nonanoate;octane.
| Compound Name | nonyl 9-[2-hydroxyethyl-(9-oxo-9-undecan-3-yloxynonyl)amino]nonanoate;octane |
|---|---|
| PubChem CID | 171840807 |
| Molecular Formula | C48H97NO5 |
| Molecular Weight | 768.31 g/mol |
| Exact Mass | 767.74 |
| IUPAC Name | nonyl 9-[2-hydroxyethyl-(9-oxo-9-undecan-3-yloxynonyl)amino]nonanoate;octane |
| SMILES | CCCCCCCC.CCCCCCCCCOC(=O)CCCCCCCCN(CCO)CCCCCCCCC(=O)OC(CC)CCCCCCCC |
| InChI | InChI=1S/C40H79NO5.C8H18/c1-4-7-9-11-17-23-29-37-45-39(43)31-25-19-13-15-21-27-33-41(35-36-42)34-28-22-16-14-20-26-32-40(44)46-38(6-3)30-24-18-12-10-8-5-2;1-3-5-7-8-6-4-2/h38,42H,4-37H2,1-3H3;3-8H2,1-2H3 |
| InChIKey | UXHRQAPRKAZJBQ-UHFFFAOYSA-N |
| XLogP | 14.48 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.31 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|