C52H101N3O5S — CID 156710179
9-methoxyheptadecane;undecan-3-yl 8-[3-(1,2-oxazol-3-ylmethylsulfanylamino)propyl-(8-oxooctyl)amino]octanoate (PubChem CID 156710179) has the molecular formula C52H101N3O5S and a molecular weight of 880.46 g/mol. Its IUPAC name is 9-methoxyheptadecane;undecan-3-yl 8-[3-(1,2-oxazol-3-ylmethylsulfanylamino)propyl-(8-oxooctyl)amino]octanoate.
| Compound Name | 9-methoxyheptadecane;undecan-3-yl 8-[3-(1,2-oxazol-3-ylmethylsulfanylamino)propyl-(8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 156710179 |
| Molecular Formula | C52H101N3O5S |
| Molecular Weight | 880.46 g/mol |
| Exact Mass | 879.75 |
| IUPAC Name | 9-methoxyheptadecane;undecan-3-yl 8-[3-(1,2-oxazol-3-ylmethylsulfanylamino)propyl-(8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC=O)CCCNSCc1ccon1.CCCCCCCCC(CCCCCCCC)OC |
| InChI | InChI=1S/C34H63N3O4S.C18H38O/c1-3-5-6-7-11-16-22-33(4-2)41-34(39)23-17-12-10-14-19-27-37(26-18-13-8-9-15-20-29-38)28-21-25-35-42-31-32-24-30-40-36-32;1-4-6-8-10-12-14-16-18(19-3)17-15-13-11-9-7-5-2/h24,29-30,33,35H,3-23,25-28,31H2,1-2H3;18H,4-17H2,1-3H3 |
| InChIKey | IXCSVJQCWQQMQG-UHFFFAOYSA-N |
| XLogP | 15.56 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.46 |
| LogP ≤ 5 | 15.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|