C34H63N3O4S — CID 167181153
3-butylheptyl 8-[3-(1,2-oxazol-3-ylmethylsulfanylamino)propyl-(8-oxooctyl)amino]octanoate (PubChem CID 167181153) has the molecular formula C34H63N3O4S and a molecular weight of 609.96 g/mol. Its IUPAC name is 3-butylheptyl 8-[3-(1,2-oxazol-3-ylmethylsulfanylamino)propyl-(8-oxooctyl)amino]octanoate.
| Compound Name | 3-butylheptyl 8-[3-(1,2-oxazol-3-ylmethylsulfanylamino)propyl-(8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 167181153 |
| Molecular Formula | C34H63N3O4S |
| Molecular Weight | 609.96 g/mol |
| Exact Mass | 609.45 |
| IUPAC Name | 3-butylheptyl 8-[3-(1,2-oxazol-3-ylmethylsulfanylamino)propyl-(8-oxooctyl)amino]octanoate |
| SMILES | CCCCC(CCCC)CCOC(=O)CCCCCCCN(CCCCCCCC=O)CCCNSCc1ccon1 |
| InChI | InChI=1S/C34H63N3O4S/c1-3-5-19-32(20-6-4-2)22-29-40-34(39)21-14-10-9-12-16-26-37(25-15-11-7-8-13-17-28-38)27-18-24-35-42-31-33-23-30-41-36-33/h23,28,30,32,35H,3-22,24-27,29,31H2,1-2H3 |
| InChIKey | OYZVCPCVPRTVTE-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.96 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|