C52H108N2O5S — CID 170754994
5-(2-methoxyethyl)nonane;8-[3-(2-methoxyethylsulfanylamino)propyl-(8-oxooctyl)amino]octanal;9-methoxyheptadecane (PubChem CID 170754994) has the molecular formula C52H108N2O5S and a molecular weight of 873.51 g/mol. Its IUPAC name is 5-(2-methoxyethyl)nonane;8-[3-(2-methoxyethylsulfanylamino)propyl-(8-oxooctyl)amino]octanal;9-methoxyheptadecane.
| Compound Name | 5-(2-methoxyethyl)nonane;8-[3-(2-methoxyethylsulfanylamino)propyl-(8-oxooctyl)amino]octanal;9-methoxyheptadecane |
|---|---|
| PubChem CID | 170754994 |
| Molecular Formula | C52H108N2O5S |
| Molecular Weight | 873.51 g/mol |
| Exact Mass | 872.80 |
| IUPAC Name | 5-(2-methoxyethyl)nonane;8-[3-(2-methoxyethylsulfanylamino)propyl-(8-oxooctyl)amino]octanal;9-methoxyheptadecane |
| SMILES | CCCCC(CCCC)CCOC.CCCCCCCCC(CCCCCCCC)OC.COCCSNCCCN(CCCCCCCC=O)CCCCCCCC=O |
| InChI | InChI=1S/C22H44N2O3S.C18H38O.C12H26O/c1-27-21-22-28-23-15-14-18-24(16-10-6-2-4-8-12-19-25)17-11-7-3-5-9-13-20-26;1-4-6-8-10-12-14-16-18(19-3)17-15-13-11-9-7-5-2;1-4-6-8-12(9-7-5-2)10-11-13-3/h19-20,23H,2-18,21-22H2,1H3;18H,4-17H2,1-3H3;12H,4-11H2,1-3H3 |
| InChIKey | FQOCPDYQHWTYBJ-UHFFFAOYSA-N |
| XLogP | 15.16 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.51 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|