C50H99N3O3S2 — CID 170756831
8-[7-(heptyldisulfanyl)heptyl-[3-[[(2Z)-2-(methylamino)-4-oxohexa-2,5-dien-3-yl]amino]propyl]amino]octanal;9-methoxyheptadecane (PubChem CID 170756831) has the molecular formula C50H99N3O3S2 and a molecular weight of 854.49 g/mol. Its IUPAC name is 8-[7-(heptyldisulfanyl)heptyl-[3-[[(2Z)-2-(methylamino)-4-oxohexa-2,5-dien-3-yl]amino]propyl]amino]octanal;9-methoxyheptadecane.
| Compound Name | 8-[7-(heptyldisulfanyl)heptyl-[3-[[(2Z)-2-(methylamino)-4-oxohexa-2,5-dien-3-yl]amino]propyl]amino]octanal;9-methoxyheptadecane |
|---|---|
| PubChem CID | 170756831 |
| Molecular Formula | C50H99N3O3S2 |
| Molecular Weight | 854.49 g/mol |
| Exact Mass | 853.71 |
| IUPAC Name | 8-[7-(heptyldisulfanyl)heptyl-[3-[[(2Z)-2-(methylamino)-4-oxohexa-2,5-dien-3-yl]amino]propyl]amino]octanal;9-methoxyheptadecane |
| SMILES | C=CC(=O)/C(NCCCN(CCCCCCCC=O)CCCCCCCSSCCCCCCC)=C(\C)NC.CCCCCCCCC(CCCCCCCC)OC |
| InChI | InChI=1S/C32H61N3O2S2.C18H38O/c1-5-7-8-15-20-28-38-39-29-21-16-11-13-18-25-35(24-17-12-9-10-14-19-27-36)26-22-23-34-32(30(3)33-4)31(37)6-2;1-4-6-8-10-12-14-16-18(19-3)17-15-13-11-9-7-5-2/h6,27,33-34H,2,5,7-26,28-29H2,1,3-4H3;18H,4-17H2,1-3H3/b32-30-; |
| InChIKey | SMFIPWDAYGCVBA-GWLNUVCFSA-N |
| XLogP | 14.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.49 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|