C51H104N6O4 — CID 171539023
9-methoxyheptadecane;undecan-3-yl 8-[3-[[(Z)-[amino-(2-methylidenehydrazinyl)methylidene]amino]methylamino]propyl-(8-oxooctyl)amino]octanoate (PubChem CID 171539023) has the molecular formula C51H104N6O4 and a molecular weight of 865.43 g/mol. Its IUPAC name is 9-methoxyheptadecane;undecan-3-yl 8-[3-[[(Z)-[amino-(2-methylidenehydrazinyl)methylidene]amino]methylamino]propyl-(8-oxooctyl)amino]octanoate.
| Compound Name | 9-methoxyheptadecane;undecan-3-yl 8-[3-[[(Z)-[amino-(2-methylidenehydrazinyl)methylidene]amino]methylamino]propyl-(8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 171539023 |
| Molecular Formula | C51H104N6O4 |
| Molecular Weight | 865.43 g/mol |
| Exact Mass | 864.81 |
| IUPAC Name | 9-methoxyheptadecane;undecan-3-yl 8-[3-[[(Z)-[amino-(2-methylidenehydrazinyl)methylidene]amino]methylamino]propyl-(8-oxooctyl)amino]octanoate |
| SMILES | C=NN/C(N)=N\CNCCCN(CCCCCCCC=O)CCCCCCCC(=O)OC(CC)CCCCCCCC.CCCCCCCCC(CCCCCCCC)OC |
| InChI | InChI=1S/C33H66N6O3.C18H38O/c1-4-6-7-8-12-17-23-31(5-2)42-32(41)24-18-13-11-15-20-27-39(26-19-14-9-10-16-21-29-40)28-22-25-36-30-37-33(34)38-35-3;1-4-6-8-10-12-14-16-18(19-3)17-15-13-11-9-7-5-2/h29,31,36H,3-28,30H2,1-2H3,(H3,34,37,38);18H,4-17H2,1-3H3 |
| InChIKey | WALYPMVHFGSPKG-UHFFFAOYSA-N |
| XLogP | 13.20 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.43 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|