C52H104N4O5 — CID 177193961
heptadecan-9-yl 8-[3-[(N-acetyl-N'-methylcarbamimidoyl)amino]propyl-(8-oxooctyl)amino]octanoate;3-methoxyundecane (PubChem CID 177193961) has the molecular formula C52H104N4O5 and a molecular weight of 865.43 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-[(N-acetyl-N'-methylcarbamimidoyl)amino]propyl-(8-oxooctyl)amino]octanoate;3-methoxyundecane.
| Compound Name | heptadecan-9-yl 8-[3-[(N-acetyl-N'-methylcarbamimidoyl)amino]propyl-(8-oxooctyl)amino]octanoate;3-methoxyundecane |
|---|---|
| PubChem CID | 177193961 |
| Molecular Formula | C52H104N4O5 |
| Molecular Weight | 865.43 g/mol |
| Exact Mass | 864.80 |
| IUPAC Name | heptadecan-9-yl 8-[3-[(N-acetyl-N'-methylcarbamimidoyl)amino]propyl-(8-oxooctyl)amino]octanoate;3-methoxyundecane |
| SMILES | CCCCCCCCC(CC)OC.CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC=O)CCCN/C(=N/C)NC(C)=O |
| InChI | InChI=1S/C40H78N4O4.C12H26O/c1-5-7-9-11-16-22-29-38(30-23-17-12-10-8-6-2)48-39(47)31-24-18-15-20-26-34-44(33-25-19-13-14-21-27-36-45)35-28-32-42-40(41-4)43-37(3)46;1-4-6-7-8-9-10-11-12(5-2)13-3/h36,38H,5-35H2,1-4H3,(H2,41,42,43,46);12H,4-11H2,1-3H3 |
| InChIKey | ZXAVEXWHJKAJIH-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.43 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|