C49H99N5O4 — CID 129232610
heptadecan-9-yl 8-[3-[(N-methoxy-N'-methylcarbamimidoyl)amino]propyl-[8-[methyl(nonyl)amino]-8-oxooctyl]amino]octanoate (PubChem CID 129232610) has the molecular formula C49H99N5O4 and a molecular weight of 822.36 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-[(N-methoxy-N'-methylcarbamimidoyl)amino]propyl-[8-[methyl(nonyl)amino]-8-oxooctyl]amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[3-[(N-methoxy-N'-methylcarbamimidoyl)amino]propyl-[8-[methyl(nonyl)amino]-8-oxooctyl]amino]octanoate |
|---|---|
| PubChem CID | 129232610 |
| Molecular Formula | C49H99N5O4 |
| Molecular Weight | 822.36 g/mol |
| Exact Mass | 821.77 |
| IUPAC Name | heptadecan-9-yl 8-[3-[(N-methoxy-N'-methylcarbamimidoyl)amino]propyl-[8-[methyl(nonyl)amino]-8-oxooctyl]amino]octanoate |
| SMILES | CCCCCCCCCN(C)C(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCN/C(=N/C)NOC |
| InChI | InChI=1S/C49H99N5O4/c1-7-10-13-16-19-26-33-42-53(5)47(55)39-31-24-20-27-34-43-54(45-36-41-51-49(50-4)52-57-6)44-35-28-21-25-32-40-48(56)58-46(37-29-22-17-14-11-8-2)38-30-23-18-15-12-9-3/h46H,7-45H2,1-6H3,(H2,50,51,52) |
| InChIKey | WEAVSDMOPPTKJA-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.36 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|