C50H102N2O4S — CID 156710094
9-methoxyheptadecane;undecan-3-yl 8-[3-(ethylaminosulfanyl)propyl-(8-oxooctyl)amino]octanoate (PubChem CID 156710094) has the molecular formula C50H102N2O4S and a molecular weight of 827.44 g/mol. Its IUPAC name is 9-methoxyheptadecane;undecan-3-yl 8-[3-(ethylaminosulfanyl)propyl-(8-oxooctyl)amino]octanoate.
| Compound Name | 9-methoxyheptadecane;undecan-3-yl 8-[3-(ethylaminosulfanyl)propyl-(8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 156710094 |
| Molecular Formula | C50H102N2O4S |
| Molecular Weight | 827.44 g/mol |
| Exact Mass | 826.76 |
| IUPAC Name | 9-methoxyheptadecane;undecan-3-yl 8-[3-(ethylaminosulfanyl)propyl-(8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC=O)CCCSNCC.CCCCCCCCC(CCCCCCCC)OC |
| InChI | InChI=1S/C32H64N2O3S.C18H38O/c1-4-7-8-9-13-18-24-31(5-2)37-32(36)25-19-14-12-16-21-27-34(28-23-30-38-33-6-3)26-20-15-10-11-17-22-29-35;1-4-6-8-10-12-14-16-18(19-3)17-15-13-11-9-7-5-2/h29,31,33H,4-28,30H2,1-3H3;18H,4-17H2,1-3H3 |
| InChIKey | RWGGVOWGAQHODZ-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.44 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|