C48H96ClNO4S — CID 156710082
heptadecan-9-yl 8-[3-chlorosulfanylpropyl(octyl)amino]octanoate;undecan-3-yl formate (PubChem CID 156710082) has the molecular formula C48H96ClNO4S and a molecular weight of 818.82 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-chlorosulfanylpropyl(octyl)amino]octanoate;undecan-3-yl formate.
| Compound Name | heptadecan-9-yl 8-[3-chlorosulfanylpropyl(octyl)amino]octanoate;undecan-3-yl formate |
|---|---|
| PubChem CID | 156710082 |
| Molecular Formula | C48H96ClNO4S |
| Molecular Weight | 818.82 g/mol |
| Exact Mass | 817.67 |
| IUPAC Name | heptadecan-9-yl 8-[3-chlorosulfanylpropyl(octyl)amino]octanoate;undecan-3-yl formate |
| SMILES | CCCCCCCCC(CC)OC=O.CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC)CCCSCl |
| InChI | InChI=1S/C36H72ClNO2S.C12H24O2/c1-4-7-10-13-17-22-28-35(29-23-18-14-11-8-5-2)40-36(39)30-24-19-16-21-26-32-38(33-27-34-41-37)31-25-20-15-12-9-6-3;1-3-5-6-7-8-9-10-12(4-2)14-11-13/h35H,4-34H2,1-3H3;11-12H,3-10H2,1-2H3 |
| InChIKey | NFZYRAMCKULHAJ-UHFFFAOYSA-N |
| XLogP | 16.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.82 |
| LogP ≤ 5 | 16.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|