C44H91NO5 — CID 170754942
formic acid;8-[2-hydroxyethyl(9-methyltetradecyl)amino]octanal;9-methoxyheptadecane (PubChem CID 170754942) has the molecular formula C44H91NO5 and a molecular weight of 714.21 g/mol. Its IUPAC name is formic acid;8-[2-hydroxyethyl(9-methyltetradecyl)amino]octanal;9-methoxyheptadecane.
| Compound Name | formic acid;8-[2-hydroxyethyl(9-methyltetradecyl)amino]octanal;9-methoxyheptadecane |
|---|---|
| PubChem CID | 170754942 |
| Molecular Formula | C44H91NO5 |
| Molecular Weight | 714.21 g/mol |
| Exact Mass | 713.69 |
| IUPAC Name | formic acid;8-[2-hydroxyethyl(9-methyltetradecyl)amino]octanal;9-methoxyheptadecane |
| SMILES | CCCCCC(C)CCCCCCCCN(CCO)CCCCCCCC=O.CCCCCCCCC(CCCCCCCC)OC.O=CO |
| InChI | InChI=1S/C25H51NO2.C18H38O.CH2O2/c1-3-4-13-18-25(2)19-14-9-5-6-10-15-20-26(22-24-28)21-16-11-7-8-12-17-23-27;1-4-6-8-10-12-14-16-18(19-3)17-15-13-11-9-7-5-2;2-1-3/h23,25,28H,3-22,24H2,1-2H3;18H,4-17H2,1-3H3;1H,(H,2,3) |
| InChIKey | QNSWRPGPYZEPKM-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.21 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|