About acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane
acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane (PubChem CID 168924738) has the molecular formula C26H55NO4
and a molecular weight of 445.73 g/mol. Its IUPAC name is acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane.
Molecular Properties
| Compound Name | acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane |
| PubChem CID | 168924738 |
| Molecular Formula | C26H55NO4 |
| Molecular Weight | 445.73 g/mol |
| Exact Mass | 445.41 |
| IUPAC Name | acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane |
| SMILES | CC=O.CCC(C)OC.CCCCCCCCN(CCCO)CCCCCCCC=O |
| InChI | InChI=1S/C19H39NO2.C5H12O.C2H4O/c1-2-3-4-5-8-11-15-20(17-14-19-22)16-12-9-6-7-10-13-18-21;1-4-5(2)6-3;1-2-3/h18,22H,2-17,19H2,1H3;5H,4H2,1-3H3;2H,1H3 |
| InChIKey | OHVYVJAIRNCBIJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane?
The IUPAC name of acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane (CID 168924738) is acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane.
What is the SMILES notation for acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane?
The canonical SMILES for acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane is CC=O.CCC(C)OC.CCCCCCCCN(CCCO)CCCCCCCC=O.
What is the InChIKey of acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane?
The InChIKey is OHVYVJAIRNCBIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NO2.C5H12O.C2H4O/c1-2-3-4-5-8-11-15-20(17-14-19-22)16-12-9-6-7-10-13-18-21;1-4-5(2)6-3;1-2-3/h18,22H,2-17,19H2,1H3;5H,4H2,1-3H3;2H,1H3.
What are the key properties of acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane?
acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane has a molecular weight of 445.73 g/mol, XLogP of 6.21, 20 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;8-[3-hydroxypropyl(octyl)amino]octanal;2-methoxybutane is sourced from PubChem (CID 168924738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).