About acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane
acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane (PubChem CID 168924423) has the molecular formula C23H49NO3
and a molecular weight of 387.65 g/mol. Its IUPAC name is acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane.
Molecular Properties
| Compound Name | acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane |
| PubChem CID | 168924423 |
| Molecular Formula | C23H49NO3 |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 387.37 |
| IUPAC Name | acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane |
| SMILES | CC=O.CCCCCCCCCN(CC)CCCCCCCC=O.COC |
| InChI | InChI=1S/C19H39NO.C2H6O.C2H4O/c1-3-5-6-7-8-11-14-17-20(4-2)18-15-12-9-10-13-16-19-21;1-3-2;1-2-3/h19H,3-18H2,1-2H3;1-2H3;2H,1H3 |
| InChIKey | GFMWXMCQXHRWBL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane?
The IUPAC name of acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane (CID 168924423) is acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane.
What is the SMILES notation for acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane?
The canonical SMILES for acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane is CC=O.CCCCCCCCCN(CC)CCCCCCCC=O.COC.
What is the InChIKey of acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane?
The InChIKey is GFMWXMCQXHRWBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NO.C2H6O.C2H4O/c1-3-5-6-7-8-11-14-17-20(4-2)18-15-12-9-10-13-16-19-21;1-3-2;1-2-3/h19H,3-18H2,1-2H3;1-2H3;2H,1H3.
What are the key properties of acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane?
acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane has a molecular weight of 387.65 g/mol, XLogP of 6.07, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;8-[ethyl(nonyl)amino]octanal;methoxymethane is sourced from PubChem (CID 168924423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).