C50H94N4O4 — CID 167180902
3-butylheptyl 8-[3-[(3-amino-2-pyridinyl)amino]propyl-(8-oxo-8-pentadecan-8-yloxyoctyl)amino]octanoate (PubChem CID 167180902) has the molecular formula C50H94N4O4 and a molecular weight of 815.33 g/mol. Its IUPAC name is 3-butylheptyl 8-[3-[(3-amino-2-pyridinyl)amino]propyl-(8-oxo-8-pentadecan-8-yloxyoctyl)amino]octanoate.
| Compound Name | 3-butylheptyl 8-[3-[(3-amino-2-pyridinyl)amino]propyl-(8-oxo-8-pentadecan-8-yloxyoctyl)amino]octanoate |
|---|---|
| PubChem CID | 167180902 |
| Molecular Formula | C50H94N4O4 |
| Molecular Weight | 815.33 g/mol |
| Exact Mass | 814.73 |
| IUPAC Name | 3-butylheptyl 8-[3-[(3-amino-2-pyridinyl)amino]propyl-(8-oxo-8-pentadecan-8-yloxyoctyl)amino]octanoate |
| SMILES | CCCCCCCC(CCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OCCC(CCCC)CCCC)CCCNc1ncccc1N |
| InChI | InChI=1S/C50H94N4O4/c1-5-9-13-17-23-33-46(34-24-18-14-10-6-2)58-49(56)37-26-20-16-22-28-42-54(43-30-40-53-50-47(51)35-29-39-52-50)41-27-21-15-19-25-36-48(55)57-44-38-45(31-11-7-3)32-12-8-4/h29,35,39,45-46H,5-28,30-34,36-38,40-44,51H2,1-4H3,(H,52,53) |
| InChIKey | WMEDJIWIQUNBJI-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.33 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|