C48H88N4O6 — CID 170694683
3-butylheptyl 8-[3-[(3-nitro-2-pyridinyl)amino]propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate (PubChem CID 170694683) has the molecular formula C48H88N4O6 and a molecular weight of 817.25 g/mol. Its IUPAC name is 3-butylheptyl 8-[3-[(3-nitro-2-pyridinyl)amino]propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate.
| Compound Name | 3-butylheptyl 8-[3-[(3-nitro-2-pyridinyl)amino]propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate |
|---|---|
| PubChem CID | 170694683 |
| Molecular Formula | C48H88N4O6 |
| Molecular Weight | 817.25 g/mol |
| Exact Mass | 816.67 |
| IUPAC Name | 3-butylheptyl 8-[3-[(3-nitro-2-pyridinyl)amino]propyl-[8-oxo-8-(3-pentyloctoxy)octyl]amino]octanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCN(CCCCCCCC(=O)OCCC(CCCC)CCCC)CCCNc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C48H88N4O6/c1-5-9-19-29-44(30-20-10-6-2)35-42-58-47(54)33-22-16-14-18-24-39-51(40-26-37-50-48-45(52(55)56)31-25-36-49-48)38-23-17-13-15-21-32-46(53)57-41-34-43(27-11-7-3)28-12-8-4/h25,31,36,43-44H,5-24,26-30,32-35,37-42H2,1-4H3,(H,49,50) |
| InChIKey | RISPSNLUYBICLX-UHFFFAOYSA-N |
| XLogP | 13.41 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.25 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|