C52H102N2O7 — CID 167299126
6-[4-acetamidobutyl-[6-(2-hexyldecoxycarbonyloxy)hexyl]amino]hexyl 2-hexyldecyl carbonate (PubChem CID 167299126) has the molecular formula C52H102N2O7 and a molecular weight of 867.39 g/mol. Its IUPAC name is 6-[4-acetamidobutyl-[6-(2-hexyldecoxycarbonyloxy)hexyl]amino]hexyl 2-hexyldecyl carbonate.
| Compound Name | 6-[4-acetamidobutyl-[6-(2-hexyldecoxycarbonyloxy)hexyl]amino]hexyl 2-hexyldecyl carbonate |
|---|---|
| PubChem CID | 167299126 |
| Molecular Formula | C52H102N2O7 |
| Molecular Weight | 867.39 g/mol |
| Exact Mass | 866.77 |
| IUPAC Name | 6-[4-acetamidobutyl-[6-(2-hexyldecoxycarbonyloxy)hexyl]amino]hexyl 2-hexyldecyl carbonate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)OCCCCCCN(CCCCCCOC(=O)OCC(CCCCCC)CCCCCCCC)CCCCNC(C)=O |
| InChI | InChI=1S/C52H102N2O7/c1-6-10-14-18-20-28-38-49(36-26-16-12-8-3)46-60-51(56)58-44-34-24-22-31-41-54(43-33-30-40-53-48(5)55)42-32-23-25-35-45-59-52(57)61-47-50(37-27-17-13-9-4)39-29-21-19-15-11-7-2/h49-50H,6-47H2,1-5H3,(H,53,55) |
| InChIKey | VIJMHPDIDSTCPB-UHFFFAOYSA-N |
| XLogP | 15.31 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.39 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|