C41H80N2O9 — CID 170389683
2-[2-(2-hexyloctoxycarbonyloxy)ethyl-[2-[3-(2-hydroxyethoxy)propanoylamino]ethyl]amino]ethyl 2-hexyloctyl carbonate (PubChem CID 170389683) has the molecular formula C41H80N2O9 and a molecular weight of 745.10 g/mol. Its IUPAC name is 2-[2-(2-hexyloctoxycarbonyloxy)ethyl-[2-[3-(2-hydroxyethoxy)propanoylamino]ethyl]amino]ethyl 2-hexyloctyl carbonate.
| Compound Name | 2-[2-(2-hexyloctoxycarbonyloxy)ethyl-[2-[3-(2-hydroxyethoxy)propanoylamino]ethyl]amino]ethyl 2-hexyloctyl carbonate |
|---|---|
| PubChem CID | 170389683 |
| Molecular Formula | C41H80N2O9 |
| Molecular Weight | 745.10 g/mol |
| Exact Mass | 744.59 |
| IUPAC Name | 2-[2-(2-hexyloctoxycarbonyloxy)ethyl-[2-[3-(2-hydroxyethoxy)propanoylamino]ethyl]amino]ethyl 2-hexyloctyl carbonate |
| SMILES | CCCCCCC(CCCCCC)COC(=O)OCCN(CCNC(=O)CCOCCO)CCOC(=O)OCC(CCCCCC)CCCCCC |
| InChI | InChI=1S/C41H80N2O9/c1-5-9-13-17-21-37(22-18-14-10-6-2)35-51-40(46)49-32-28-43(27-26-42-39(45)25-31-48-34-30-44)29-33-50-41(47)52-36-38(23-19-15-11-7-3)24-20-16-12-8-4/h37-38,44H,5-36H2,1-4H3,(H,42,45) |
| InChIKey | CMCDYWNBBNRXDD-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.10 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|