C44H87NO6 — CID 164551963
6-[6-(2-butyloctoxycarbonyloxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-hexyldecanoate (PubChem CID 164551963) has the molecular formula C44H87NO6 and a molecular weight of 726.18 g/mol. Its IUPAC name is 6-[6-(2-butyloctoxycarbonyloxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[6-(2-butyloctoxycarbonyloxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 164551963 |
| Molecular Formula | C44H87NO6 |
| Molecular Weight | 726.18 g/mol |
| Exact Mass | 725.65 |
| IUPAC Name | 6-[6-(2-butyloctoxycarbonyloxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CCCO)CCCCCCOC(=O)OCC(CCCC)CCCCCC |
| InChI | InChI=1S/C44H87NO6/c1-5-9-13-16-17-24-33-42(32-23-15-11-7-3)43(47)49-38-27-20-18-25-34-45(36-29-37-46)35-26-19-21-28-39-50-44(48)51-40-41(30-12-8-4)31-22-14-10-6-2/h41-42,46H,5-40H2,1-4H3 |
| InChIKey | IFUWFVIBGDPEOI-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.18 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|