About 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate
6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate (PubChem CID 163299517) has the molecular formula C39H79NO4
and a molecular weight of 626.06 g/mol. Its IUPAC name is 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate.
Molecular Properties
| Compound Name | 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate |
| PubChem CID | 163299517 |
| Molecular Formula | C39H79NO4 |
| Molecular Weight | 626.06 g/mol |
| Exact Mass | 625.60 |
| IUPAC Name | 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate |
| SMILES | CCCCCCC(CCCC)COCCCCCCN(CCCO)CCCCCCOC(=O)C(CCCC)CCCCCC |
| InChI | InChI=1S/C39H79NO4/c1-5-9-13-19-27-37(26-11-7-3)36-43-34-23-17-15-21-30-40(32-25-33-41)31-22-16-18-24-35-44-39(42)38(28-12-8-4)29-20-14-10-6-2/h37-38,41H,5-36H2,1-4H3 |
| InChIKey | LJZUHMBDQIIUOI-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 626.06 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate?
The IUPAC name of 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate (CID 163299517) is 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate.
What is the SMILES notation for 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate?
The canonical SMILES for 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate is CCCCCCC(CCCC)COCCCCCCN(CCCO)CCCCCCOC(=O)C(CCCC)CCCCCC.
What is the InChIKey of 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate?
The InChIKey is LJZUHMBDQIIUOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H79NO4/c1-5-9-13-19-27-37(26-11-7-3)36-43-34-23-17-15-21-30-40(32-25-33-41)31-22-16-18-24-35-44-39(42)38(28-12-8-4)29-20-14-10-6-2/h37-38,41H,5-36H2,1-4H3.
What are the key properties of 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate?
6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate has a molecular weight of 626.06 g/mol, XLogP of 10.90, 36 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate is sourced from PubChem (CID 163299517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).