C39H79NO4 — CID 163299517
6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate (PubChem CID 163299517) has the molecular formula C39H79NO4 and a molecular weight of 626.06 g/mol. Its IUPAC name is 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate.
| Compound Name | 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate |
|---|---|
| PubChem CID | 163299517 |
| Molecular Formula | C39H79NO4 |
| Molecular Weight | 626.06 g/mol |
| Exact Mass | 625.60 |
| IUPAC Name | 6-[6-(2-butyloctoxy)hexyl-(3-hydroxypropyl)amino]hexyl 2-butyloctanoate |
| SMILES | CCCCCCC(CCCC)COCCCCCCN(CCCO)CCCCCCOC(=O)C(CCCC)CCCCCC |
| InChI | InChI=1S/C39H79NO4/c1-5-9-13-19-27-37(26-11-7-3)36-43-34-23-17-15-21-30-40(32-25-33-41)31-22-16-18-24-35-44-39(42)38(28-12-8-4)29-20-14-10-6-2/h37-38,41H,5-36H2,1-4H3 |
| InChIKey | LJZUHMBDQIIUOI-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.06 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|