C52H98N2O11 — CID 162764282
1-O-decyl 7-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[6-(2-hexyldecanoyloxy)hexylcarbamoyloxy]propyl] heptanedioate (PubChem CID 162764282) has the molecular formula C52H98N2O11 and a molecular weight of 927.36 g/mol. Its IUPAC name is 1-O-decyl 7-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[6-(2-hexyldecanoyloxy)hexylcarbamoyloxy]propyl] heptanedioate.
| Compound Name | 1-O-decyl 7-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[6-(2-hexyldecanoyloxy)hexylcarbamoyloxy]propyl] heptanedioate |
|---|---|
| PubChem CID | 162764282 |
| Molecular Formula | C52H98N2O11 |
| Molecular Weight | 927.36 g/mol |
| Exact Mass | 926.72 |
| IUPAC Name | 1-O-decyl 7-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[6-(2-hexyldecanoyloxy)hexylcarbamoyloxy]propyl] heptanedioate |
| SMILES | CCCCCCCCCCOC(=O)CCCCCC(=O)OCC(COC(=O)NCCCCCCOC(=O)C(CCCCCC)CCCCCCCC)COC(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C52H98N2O11/c1-6-11-14-17-19-20-23-31-40-60-48(55)36-28-25-29-37-49(56)63-43-46(45-65-52(59)62-42-33-39-54(9-4)10-5)44-64-51(58)53-38-30-22-24-32-41-61-50(57)47(34-26-16-13-8-3)35-27-21-18-15-12-7-2/h46-47H,6-45H2,1-5H3,(H,53,58) |
| InChIKey | LDMIPVUWDGVMAP-UHFFFAOYSA-N |
| XLogP | 12.83 |
| TPSA | 156.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.36 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|