C50H96N2O10 — CID 155246021
1-O-decyl 9-O-[2-[2-(diethylamino)ethylcarbamoyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] nonanedioate (PubChem CID 155246021) has the molecular formula C50H96N2O10 and a molecular weight of 885.32 g/mol. Its IUPAC name is 1-O-decyl 9-O-[2-[2-(diethylamino)ethylcarbamoyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] nonanedioate.
| Compound Name | 1-O-decyl 9-O-[2-[2-(diethylamino)ethylcarbamoyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] nonanedioate |
|---|---|
| PubChem CID | 155246021 |
| Molecular Formula | C50H96N2O10 |
| Molecular Weight | 885.32 g/mol |
| Exact Mass | 884.71 |
| IUPAC Name | 1-O-decyl 9-O-[2-[2-(diethylamino)ethylcarbamoyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] nonanedioate |
| SMILES | CCCCCCCCCCOC(=O)CCCCCCCC(=O)OCC(COC(=O)CCC(OCCCCCCCC)OCCCCCCCC)COC(=O)NCCN(CC)CC |
| InChI | InChI=1S/C50H96N2O10/c1-6-11-14-17-20-21-27-30-39-57-46(53)33-28-23-22-24-29-34-47(54)60-42-45(44-62-50(56)51-37-38-52(9-4)10-5)43-61-48(55)35-36-49(58-40-31-25-18-15-12-7-2)59-41-32-26-19-16-13-8-3/h45,49H,6-44H2,1-5H3,(H,51,56) |
| InChIKey | RNRXPFHNHZVAJQ-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.32 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|