C49H92N2O9 — CID 172607768
1-O-[2-[2-(diethylamino)ethylcarbamoyloxymethyl]-3-[(Z)-7-oxo-7-tridecan-7-yloxyhept-2-en-3-yl]oxypropyl] 5-O-tridecan-7-yl pentanedioate (PubChem CID 172607768) has the molecular formula C49H92N2O9 and a molecular weight of 853.28 g/mol. Its IUPAC name is 1-O-[2-[2-(diethylamino)ethylcarbamoyloxymethyl]-3-[(Z)-7-oxo-7-tridecan-7-yloxyhept-2-en-3-yl]oxypropyl] 5-O-tridecan-7-yl pentanedioate.
| Compound Name | 1-O-[2-[2-(diethylamino)ethylcarbamoyloxymethyl]-3-[(Z)-7-oxo-7-tridecan-7-yloxyhept-2-en-3-yl]oxypropyl] 5-O-tridecan-7-yl pentanedioate |
|---|---|
| PubChem CID | 172607768 |
| Molecular Formula | C49H92N2O9 |
| Molecular Weight | 853.28 g/mol |
| Exact Mass | 852.68 |
| IUPAC Name | 1-O-[2-[2-(diethylamino)ethylcarbamoyloxymethyl]-3-[(Z)-7-oxo-7-tridecan-7-yloxyhept-2-en-3-yl]oxypropyl] 5-O-tridecan-7-yl pentanedioate |
| SMILES | C/C=C(/CCCC(=O)OC(CCCCCC)CCCCCC)OCC(COC(=O)CCCC(=O)OC(CCCCCC)CCCCCC)COC(=O)NCCN(CC)CC |
| InChI | InChI=1S/C49H92N2O9/c1-8-15-19-23-29-44(30-24-20-16-9-2)59-47(53)35-27-33-43(12-5)56-39-42(41-58-49(55)50-37-38-51(13-6)14-7)40-57-46(52)34-28-36-48(54)60-45(31-25-21-17-10-3)32-26-22-18-11-4/h12,42,44-45H,8-11,13-41H2,1-7H3,(H,50,55)/b43-12- |
| InChIKey | VZGMNBKROKKYAP-QEMDGBMQSA-N |
| XLogP | 12.18 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.28 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|