C56H106N2O10 — CID 172607781
1-O-[2-[2-(diethylamino)ethylcarbamoyloxymethyl]-3-(5-heptadecan-9-yloxy-5-oxopentanoyl)oxy-2-methylpropyl] 5-O-heptadecan-9-yl pentanedioate (PubChem CID 172607781) has the molecular formula C56H106N2O10 and a molecular weight of 967.47 g/mol. Its IUPAC name is 1-O-[2-[2-(diethylamino)ethylcarbamoyloxymethyl]-3-(5-heptadecan-9-yloxy-5-oxopentanoyl)oxy-2-methylpropyl] 5-O-heptadecan-9-yl pentanedioate.
| Compound Name | 1-O-[2-[2-(diethylamino)ethylcarbamoyloxymethyl]-3-(5-heptadecan-9-yloxy-5-oxopentanoyl)oxy-2-methylpropyl] 5-O-heptadecan-9-yl pentanedioate |
|---|---|
| PubChem CID | 172607781 |
| Molecular Formula | C56H106N2O10 |
| Molecular Weight | 967.47 g/mol |
| Exact Mass | 966.78 |
| IUPAC Name | 1-O-[2-[2-(diethylamino)ethylcarbamoyloxymethyl]-3-(5-heptadecan-9-yloxy-5-oxopentanoyl)oxy-2-methylpropyl] 5-O-heptadecan-9-yl pentanedioate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCC(=O)OCC(C)(COC(=O)CCCC(=O)OC(CCCCCCCC)CCCCCCCC)COC(=O)NCCN(CC)CC |
| InChI | InChI=1S/C56H106N2O10/c1-8-14-18-22-26-30-36-49(37-31-27-23-19-15-9-2)67-53(61)42-34-40-51(59)64-46-56(7,48-66-55(63)57-44-45-58(12-5)13-6)47-65-52(60)41-35-43-54(62)68-50(38-32-28-24-20-16-10-3)39-33-29-25-21-17-11-4/h49-50H,8-48H2,1-7H3,(H,57,63) |
| InChIKey | TYAACJVRMVWGBV-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.47 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|