C20H40N2O4 — CID 175983071
propyl 4-[2-(diethylamino)ethylcarbamoyloxy]decanoate (PubChem CID 175983071) has the molecular formula C20H40N2O4 and a molecular weight of 372.55 g/mol. Its IUPAC name is propyl 4-[2-(diethylamino)ethylcarbamoyloxy]decanoate.
| Compound Name | propyl 4-[2-(diethylamino)ethylcarbamoyloxy]decanoate |
|---|---|
| PubChem CID | 175983071 |
| Molecular Formula | C20H40N2O4 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | propyl 4-[2-(diethylamino)ethylcarbamoyloxy]decanoate |
| SMILES | CCCCCCC(CCC(=O)OCCC)OC(=O)NCCN(CC)CC |
| InChI | InChI=1S/C20H40N2O4/c1-5-9-10-11-12-18(13-14-19(23)25-17-6-2)26-20(24)21-15-16-22(7-3)8-4/h18H,5-17H2,1-4H3,(H,21,24) |
| InChIKey | APYSKGPQZPHMNF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|