C41H80N4O8 — CID 177084840
3-(undecan-4-yloxycarbonylamino)propyl 3-[methyl-[3-[methyl-[3-oxo-3-[3-(undecan-4-yloxycarbonylamino)propoxy]propyl]amino]propyl]amino]propanoate (PubChem CID 177084840) has the molecular formula C41H80N4O8 and a molecular weight of 757.11 g/mol. Its IUPAC name is 3-(undecan-4-yloxycarbonylamino)propyl 3-[methyl-[3-[methyl-[3-oxo-3-[3-(undecan-4-yloxycarbonylamino)propoxy]propyl]amino]propyl]amino]propanoate.
| Compound Name | 3-(undecan-4-yloxycarbonylamino)propyl 3-[methyl-[3-[methyl-[3-oxo-3-[3-(undecan-4-yloxycarbonylamino)propoxy]propyl]amino]propyl]amino]propanoate |
|---|---|
| PubChem CID | 177084840 |
| Molecular Formula | C41H80N4O8 |
| Molecular Weight | 757.11 g/mol |
| Exact Mass | 756.60 |
| IUPAC Name | 3-(undecan-4-yloxycarbonylamino)propyl 3-[methyl-[3-[methyl-[3-oxo-3-[3-(undecan-4-yloxycarbonylamino)propoxy]propyl]amino]propyl]amino]propanoate |
| SMILES | CCCCCCCC(CCC)OC(=O)NCCCOC(=O)CCN(C)CCCN(C)CCC(=O)OCCCNC(=O)OC(CCC)CCCCCCC |
| InChI | InChI=1S/C41H80N4O8/c1-7-11-13-15-17-24-36(22-9-3)52-40(48)42-28-19-34-50-38(46)26-32-44(5)30-21-31-45(6)33-27-39(47)51-35-20-29-43-41(49)53-37(23-10-4)25-18-16-14-12-8-2/h36-37H,7-35H2,1-6H3,(H,42,48)(H,43,49) |
| InChIKey | WQJNKSKASYHGTR-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.11 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|