C49H97N3O5 — CID 146475436
nonyl 8-[4-(dimethylamino)butylcarbamoyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 146475436) has the molecular formula C49H97N3O5 and a molecular weight of 808.33 g/mol. Its IUPAC name is nonyl 8-[4-(dimethylamino)butylcarbamoyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | nonyl 8-[4-(dimethylamino)butylcarbamoyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 146475436 |
| Molecular Formula | C49H97N3O5 |
| Molecular Weight | 808.33 g/mol |
| Exact Mass | 807.74 |
| IUPAC Name | nonyl 8-[4-(dimethylamino)butylcarbamoyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)C(=O)NCCCCN(C)C |
| InChI | InChI=1S/C49H97N3O5/c1-6-9-12-15-18-27-36-45-56-47(53)39-30-23-19-25-33-43-52(49(55)50-41-32-35-42-51(4)5)44-34-26-20-24-31-40-48(54)57-46(37-28-21-16-13-10-7-2)38-29-22-17-14-11-8-3/h46H,6-45H2,1-5H3,(H,50,55) |
| InChIKey | VDKYVXGYDCUVRG-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.33 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|