C47H93N3O5 — CID 146475435
nonyl 8-[2-(dimethylamino)ethylcarbamoyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 146475435) has the molecular formula C47H93N3O5 and a molecular weight of 780.28 g/mol. Its IUPAC name is nonyl 8-[2-(dimethylamino)ethylcarbamoyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | nonyl 8-[2-(dimethylamino)ethylcarbamoyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 146475435 |
| Molecular Formula | C47H93N3O5 |
| Molecular Weight | 780.28 g/mol |
| Exact Mass | 779.71 |
| IUPAC Name | nonyl 8-[2-(dimethylamino)ethylcarbamoyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)C(=O)NCCN(C)C |
| InChI | InChI=1S/C47H93N3O5/c1-6-9-12-15-18-27-34-43-54-45(51)37-30-23-19-25-32-40-50(47(53)48-39-42-49(4)5)41-33-26-20-24-31-38-46(52)55-44(35-28-21-16-13-10-7-2)36-29-22-17-14-11-8-3/h44H,6-43H2,1-5H3,(H,48,53) |
| InChIKey | OWXXJUCSHWEIGU-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.28 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|