C36H71N3O6 — CID 177227150
6-[5-[2-(diethylamino)ethylcarbamoyl]pyrrolidin-3-yl]oxyhexyl 5,5-diheptoxypentanoate (PubChem CID 177227150) has the molecular formula C36H71N3O6 and a molecular weight of 641.98 g/mol. Its IUPAC name is 6-[5-[2-(diethylamino)ethylcarbamoyl]pyrrolidin-3-yl]oxyhexyl 5,5-diheptoxypentanoate.
| Compound Name | 6-[5-[2-(diethylamino)ethylcarbamoyl]pyrrolidin-3-yl]oxyhexyl 5,5-diheptoxypentanoate |
|---|---|
| PubChem CID | 177227150 |
| Molecular Formula | C36H71N3O6 |
| Molecular Weight | 641.98 g/mol |
| Exact Mass | 641.53 |
| IUPAC Name | 6-[5-[2-(diethylamino)ethylcarbamoyl]pyrrolidin-3-yl]oxyhexyl 5,5-diheptoxypentanoate |
| SMILES | CCCCCCCOC(CCCC(=O)OCCCCCCOC1CNC(C(=O)NCCN(CC)CC)C1)OCCCCCCC |
| InChI | InChI=1S/C36H71N3O6/c1-5-9-11-13-19-28-44-35(45-29-20-14-12-10-6-2)23-21-22-34(40)43-27-18-16-15-17-26-42-32-30-33(38-31-32)36(41)37-24-25-39(7-3)8-4/h32-33,35,38H,5-31H2,1-4H3,(H,37,41) |
| InChIKey | OXAWSEVPKPSPCF-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.98 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|