C70H130N2O12 — CID 178033221
[3,5-bis[4-(diethylamino)butanoyloxymethyl]-7-(4,4-dioctoxybutanoyloxymethyl)-1-adamantyl]methyl 4,4-dioctoxybutanoate (PubChem CID 178033221) has the molecular formula C70H130N2O12 and a molecular weight of 1191.81 g/mol. Its IUPAC name is [3,5-bis[4-(diethylamino)butanoyloxymethyl]-7-(4,4-dioctoxybutanoyloxymethyl)-1-adamantyl]methyl 4,4-dioctoxybutanoate.
| Compound Name | [3,5-bis[4-(diethylamino)butanoyloxymethyl]-7-(4,4-dioctoxybutanoyloxymethyl)-1-adamantyl]methyl 4,4-dioctoxybutanoate |
|---|---|
| PubChem CID | 178033221 |
| Molecular Formula | C70H130N2O12 |
| Molecular Weight | 1191.81 g/mol |
| Exact Mass | 1190.96 |
| IUPAC Name | [3,5-bis[4-(diethylamino)butanoyloxymethyl]-7-(4,4-dioctoxybutanoyloxymethyl)-1-adamantyl]methyl 4,4-dioctoxybutanoate |
| SMILES | CCCCCCCCOC(CCC(=O)OCC12CC3(COC(=O)CCCN(CC)CC)CC(COC(=O)CCCN(CC)CC)(C1)CC(COC(=O)CCC(OCCCCCCCC)OCCCCCCCC)(C3)C2)OCCCCCCCC |
| InChI | InChI=1S/C70H130N2O12/c1-9-17-21-25-29-33-47-77-65(78-48-34-30-26-22-18-10-2)43-41-63(75)83-59-69-52-67(57-81-61(73)39-37-45-71(13-5)14-6)51-68(53-69,58-82-62(74)40-38-46-72(15-7)16-8)55-70(54-67,56-69)60-84-64(76)42-44-66(79-49-35-31-27-23-19-11-3)80-50-36-32-28-24-20-12-4/h65-66H,9-60H2,1-8H3 |
| InChIKey | TWUUHBREETZDQA-UHFFFAOYSA-N |
| XLogP | 16.45 |
| TPSA | 148.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 58 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1191.81 |
| LogP ≤ 5 | 16.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|