C59H107NO8 — CID 177137760
[1,8-bis(4-butyloctanoyloxymethyl)-6-[4-(diethylamino)butanoyloxymethyl]-3-tricyclo[4.3.1.13,8]undecanyl]methyl 4-butyloctanoate (PubChem CID 177137760) has the molecular formula C59H107NO8 and a molecular weight of 958.50 g/mol. Its IUPAC name is [1,8-bis(4-butyloctanoyloxymethyl)-6-[4-(diethylamino)butanoyloxymethyl]-3-tricyclo[4.3.1.13,8]undecanyl]methyl 4-butyloctanoate.
| Compound Name | [1,8-bis(4-butyloctanoyloxymethyl)-6-[4-(diethylamino)butanoyloxymethyl]-3-tricyclo[4.3.1.13,8]undecanyl]methyl 4-butyloctanoate |
|---|---|
| PubChem CID | 177137760 |
| Molecular Formula | C59H107NO8 |
| Molecular Weight | 958.50 g/mol |
| Exact Mass | 957.80 |
| IUPAC Name | [1,8-bis(4-butyloctanoyloxymethyl)-6-[4-(diethylamino)butanoyloxymethyl]-3-tricyclo[4.3.1.13,8]undecanyl]methyl 4-butyloctanoate |
| SMILES | CCCCC(CCCC)CCC(=O)OCC12CCC3(COC(=O)CCCN(CC)CC)CC(COC(=O)CCC(CCCC)CCCC)(C1)CC(COC(=O)CCC(CCCC)CCCC)(C3)C2 |
| InChI | InChI=1S/C59H107NO8/c1-9-17-24-49(25-18-10-2)31-34-53(62)66-46-57-38-37-56(45-65-52(61)30-23-39-60(15-7)16-8)40-58(42-57,47-67-54(63)35-32-50(26-19-11-3)27-20-12-4)44-59(41-56,43-57)48-68-55(64)36-33-51(28-21-13-5)29-22-14-6/h49-51H,9-48H2,1-8H3 |
| InChIKey | UHYZPDDDGVWXMX-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.50 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|