C62H113NO6 — CID 177137498
[6-[4-(diethylamino)butanoyloxymethyl]-7-methyl-8-(3-nonyldodecanoyloxymethyl)-3-tetracyclo[4.2.0.02,5.03,8]octanyl]methyl 3-nonyldodecanoate (PubChem CID 177137498) has the molecular formula C62H113NO6 and a molecular weight of 968.59 g/mol. Its IUPAC name is [6-[4-(diethylamino)butanoyloxymethyl]-7-methyl-8-(3-nonyldodecanoyloxymethyl)-3-tetracyclo[4.2.0.02,5.03,8]octanyl]methyl 3-nonyldodecanoate.
| Compound Name | [6-[4-(diethylamino)butanoyloxymethyl]-7-methyl-8-(3-nonyldodecanoyloxymethyl)-3-tetracyclo[4.2.0.02,5.03,8]octanyl]methyl 3-nonyldodecanoate |
|---|---|
| PubChem CID | 177137498 |
| Molecular Formula | C62H113NO6 |
| Molecular Weight | 968.59 g/mol |
| Exact Mass | 967.86 |
| IUPAC Name | [6-[4-(diethylamino)butanoyloxymethyl]-7-methyl-8-(3-nonyldodecanoyloxymethyl)-3-tetracyclo[4.2.0.02,5.03,8]octanyl]methyl 3-nonyldodecanoate |
| SMILES | CCCCCCCCCC(CCCCCCCCC)CC(=O)OCC12CC3C1C1C3(COC(=O)CCCN(CC)CC)C(C)C12COC(=O)CC(CCCCCCCCC)CCCCCCCCC |
| InChI | InChI=1S/C62H113NO6/c1-8-14-18-22-26-30-34-39-52(40-35-31-27-23-19-15-9-2)45-56(65)67-48-60-47-54-58(60)59-61(54,49-68-55(64)43-38-44-63(12-5)13-6)51(7)62(59,60)50-69-57(66)46-53(41-36-32-28-24-20-16-10-3)42-37-33-29-25-21-17-11-4/h51-54,58-59H,8-50H2,1-7H3 |
| InChIKey | XDSBVMKRGJFHOE-UHFFFAOYSA-N |
| XLogP | 17.20 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.59 |
| LogP ≤ 5 | 17.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|