C54H99NO6 — CID 178033183
3-[3-(3-nonoxy-3-oxopropyl)-5-[3-(2-octyldecoxy)-3-oxopropyl]-1-adamantyl]propyl 4-(diethylamino)butanoate (PubChem CID 178033183) has the molecular formula C54H99NO6 and a molecular weight of 858.39 g/mol. Its IUPAC name is 3-[3-(3-nonoxy-3-oxopropyl)-5-[3-(2-octyldecoxy)-3-oxopropyl]-1-adamantyl]propyl 4-(diethylamino)butanoate.
| Compound Name | 3-[3-(3-nonoxy-3-oxopropyl)-5-[3-(2-octyldecoxy)-3-oxopropyl]-1-adamantyl]propyl 4-(diethylamino)butanoate |
|---|---|
| PubChem CID | 178033183 |
| Molecular Formula | C54H99NO6 |
| Molecular Weight | 858.39 g/mol |
| Exact Mass | 857.75 |
| IUPAC Name | 3-[3-(3-nonoxy-3-oxopropyl)-5-[3-(2-octyldecoxy)-3-oxopropyl]-1-adamantyl]propyl 4-(diethylamino)butanoate |
| SMILES | CCCCCCCCCOC(=O)CCC12CC3CC(CCCOC(=O)CCCN(CC)CC)(C1)CC(CCC(=O)OCC(CCCCCCCC)CCCCCCCC)(C3)C2 |
| InChI | InChI=1S/C54H99NO6/c1-6-11-14-17-20-23-26-38-59-50(57)32-35-53-41-48-40-52(44-53,34-28-39-60-49(56)31-27-37-55(9-4)10-5)45-54(42-48,46-53)36-33-51(58)61-43-47(29-24-21-18-15-12-7-2)30-25-22-19-16-13-8-3/h47-48H,6-46H2,1-5H3 |
| InChIKey | HIILIIVSRWQTQV-UHFFFAOYSA-N |
| XLogP | 14.90 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.39 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|