C45H87NO5 — CID 176602335
2-heptylnonyl 8-[2-hydroxyethyl-[5-[1-(2-nonoxy-2-oxoethyl)cyclopropyl]pentyl]amino]octanoate (PubChem CID 176602335) has the molecular formula C45H87NO5 and a molecular weight of 722.19 g/mol. Its IUPAC name is 2-heptylnonyl 8-[2-hydroxyethyl-[5-[1-(2-nonoxy-2-oxoethyl)cyclopropyl]pentyl]amino]octanoate.
| Compound Name | 2-heptylnonyl 8-[2-hydroxyethyl-[5-[1-(2-nonoxy-2-oxoethyl)cyclopropyl]pentyl]amino]octanoate |
|---|---|
| PubChem CID | 176602335 |
| Molecular Formula | C45H87NO5 |
| Molecular Weight | 722.19 g/mol |
| Exact Mass | 721.66 |
| IUPAC Name | 2-heptylnonyl 8-[2-hydroxyethyl-[5-[1-(2-nonoxy-2-oxoethyl)cyclopropyl]pentyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CC1(CCCCCN(CCO)CCCCCCCC(=O)OCC(CCCCCCC)CCCCCCC)CC1 |
| InChI | InChI=1S/C45H87NO5/c1-4-7-10-13-14-20-28-39-50-44(49)40-45(33-34-45)32-25-21-27-36-46(37-38-47)35-26-19-15-18-24-31-43(48)51-41-42(29-22-16-11-8-5-2)30-23-17-12-9-6-3/h42,47H,4-41H2,1-3H3 |
| InChIKey | UDIWJBCAQANRLT-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.19 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|