C63H115NO8 — CID 177137816
3-[3-[3-[4-(diethylamino)butanoyloxy]propyl]-5-[3-(4,4-dioctoxybutanoyloxy)propyl]-1-adamantyl]propyl (Z)-hexadec-9-enoate (PubChem CID 177137816) has the molecular formula C63H115NO8 and a molecular weight of 1014.61 g/mol. Its IUPAC name is 3-[3-[3-[4-(diethylamino)butanoyloxy]propyl]-5-[3-(4,4-dioctoxybutanoyloxy)propyl]-1-adamantyl]propyl (Z)-hexadec-9-enoate.
| Compound Name | 3-[3-[3-[4-(diethylamino)butanoyloxy]propyl]-5-[3-(4,4-dioctoxybutanoyloxy)propyl]-1-adamantyl]propyl (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 177137816 |
| Molecular Formula | C63H115NO8 |
| Molecular Weight | 1014.61 g/mol |
| Exact Mass | 1013.86 |
| IUPAC Name | 3-[3-[3-[4-(diethylamino)butanoyloxy]propyl]-5-[3-(4,4-dioctoxybutanoyloxy)propyl]-1-adamantyl]propyl (Z)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OCCCC12CC3CC(CCCOC(=O)CCCN(CC)CC)(C1)CC(CCCOC(=O)CCC(OCCCCCCCC)OCCCCCCCC)(C3)C2 |
| InChI | InChI=1S/C63H115NO8/c1-6-11-14-17-20-21-22-23-24-25-26-27-30-37-57(65)68-47-34-41-61-50-56-51-62(53-61,42-35-48-69-58(66)38-33-44-64(9-4)10-5)55-63(52-56,54-61)43-36-49-70-59(67)39-40-60(71-45-31-28-18-15-12-7-2)72-46-32-29-19-16-13-8-3/h21-22,56,60H,6-20,23-55H2,1-5H3/b22-21- |
| InChIKey | ZDCLUFXELOENAA-DQRAZIAOSA-N |
| XLogP | 17.15 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.61 |
| LogP ≤ 5 | 17.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|