C55H101NO6 — CID 177137427
3-[3-(3-decanoyloxypropyl)-6-[3-[4-(diethylamino)butanoyloxy]propyl]-1-tricyclo[4.3.1.13,8]undecanyl]propyl 3-hexylundecanoate (PubChem CID 177137427) has the molecular formula C55H101NO6 and a molecular weight of 872.41 g/mol. Its IUPAC name is 3-[3-(3-decanoyloxypropyl)-6-[3-[4-(diethylamino)butanoyloxy]propyl]-1-tricyclo[4.3.1.13,8]undecanyl]propyl 3-hexylundecanoate.
| Compound Name | 3-[3-(3-decanoyloxypropyl)-6-[3-[4-(diethylamino)butanoyloxy]propyl]-1-tricyclo[4.3.1.13,8]undecanyl]propyl 3-hexylundecanoate |
|---|---|
| PubChem CID | 177137427 |
| Molecular Formula | C55H101NO6 |
| Molecular Weight | 872.41 g/mol |
| Exact Mass | 871.76 |
| IUPAC Name | 3-[3-(3-decanoyloxypropyl)-6-[3-[4-(diethylamino)butanoyloxy]propyl]-1-tricyclo[4.3.1.13,8]undecanyl]propyl 3-hexylundecanoate |
| SMILES | CCCCCCCCCC(=O)OCCCC12CCC3(CCCOC(=O)CCCN(CC)CC)CC(C1)CC(CCCOC(=O)CC(CCCCCC)CCCCCCCC)(C2)C3 |
| InChI | InChI=1S/C55H101NO6/c1-6-11-14-17-19-21-24-31-50(57)60-39-26-33-53-36-37-54(34-27-40-61-51(58)32-25-38-56(9-4)10-5)44-49(43-53)45-55(46-53,47-54)35-28-41-62-52(59)42-48(29-22-16-13-8-3)30-23-20-18-15-12-7-2/h48-49H,6-47H2,1-5H3 |
| InChIKey | LGCKPYDUBBYNFX-UHFFFAOYSA-N |
| XLogP | 15.29 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.41 |
| LogP ≤ 5 | 15.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|