C50H92O5 — CID 177137667
3-[3-[3-(6-butyldodecanoyloxy)propyl]-7-(3-hydroxypropyl)-1-tricyclo[3.3.1.03,7]nonanyl]propyl 6-butyldodecanoate (PubChem CID 177137667) has the molecular formula C50H92O5 and a molecular weight of 773.28 g/mol. Its IUPAC name is 3-[3-[3-(6-butyldodecanoyloxy)propyl]-7-(3-hydroxypropyl)-1-tricyclo[3.3.1.03,7]nonanyl]propyl 6-butyldodecanoate.
| Compound Name | 3-[3-[3-(6-butyldodecanoyloxy)propyl]-7-(3-hydroxypropyl)-1-tricyclo[3.3.1.03,7]nonanyl]propyl 6-butyldodecanoate |
|---|---|
| PubChem CID | 177137667 |
| Molecular Formula | C50H92O5 |
| Molecular Weight | 773.28 g/mol |
| Exact Mass | 772.69 |
| IUPAC Name | 3-[3-[3-(6-butyldodecanoyloxy)propyl]-7-(3-hydroxypropyl)-1-tricyclo[3.3.1.03,7]nonanyl]propyl 6-butyldodecanoate |
| SMILES | CCCCCCC(CCCC)CCCCC(=O)OCCCC12CC3CC(CCCO)(C1)C(CCCOC(=O)CCCCC(CCCC)CCCCCC)(C3)C2 |
| InChI | InChI=1S/C50H92O5/c1-5-9-13-15-26-43(24-11-7-3)28-17-19-30-46(52)54-36-22-32-48-38-45-39-49(41-48,33-21-35-51)50(40-45,42-48)34-23-37-55-47(53)31-20-18-29-44(25-12-8-4)27-16-14-10-6-2/h43-45,51H,5-42H2,1-4H3 |
| InChIKey | XTQDPVAZLKMIIG-UHFFFAOYSA-N |
| XLogP | 14.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.28 |
| LogP ≤ 5 | 14.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|