C48H87NO6 — CID 177137636
[6-[4-(diethylamino)butanoyloxymethyl]-1-(3-pentyloctanoyloxymethyl)-3-tricyclo[4.3.1.13,8]undecanyl]methyl 3-pentyloctanoate (PubChem CID 177137636) has the molecular formula C48H87NO6 and a molecular weight of 774.22 g/mol. Its IUPAC name is [6-[4-(diethylamino)butanoyloxymethyl]-1-(3-pentyloctanoyloxymethyl)-3-tricyclo[4.3.1.13,8]undecanyl]methyl 3-pentyloctanoate.
| Compound Name | [6-[4-(diethylamino)butanoyloxymethyl]-1-(3-pentyloctanoyloxymethyl)-3-tricyclo[4.3.1.13,8]undecanyl]methyl 3-pentyloctanoate |
|---|---|
| PubChem CID | 177137636 |
| Molecular Formula | C48H87NO6 |
| Molecular Weight | 774.22 g/mol |
| Exact Mass | 773.65 |
| IUPAC Name | [6-[4-(diethylamino)butanoyloxymethyl]-1-(3-pentyloctanoyloxymethyl)-3-tricyclo[4.3.1.13,8]undecanyl]methyl 3-pentyloctanoate |
| SMILES | CCCCCC(CCCCC)CC(=O)OCC12CCC3(COC(=O)CCCN(CC)CC)CC(C1)CC(COC(=O)CC(CCCCC)CCCCC)(C3)C2 |
| InChI | InChI=1S/C48H87NO6/c1-7-13-17-22-40(23-18-14-8-2)30-44(51)54-38-47-28-27-46(37-53-43(50)26-21-29-49(11-5)12-6)32-42(33-47)34-48(35-46,36-47)39-55-45(52)31-41(24-19-15-9-3)25-20-16-10-4/h40-42H,7-39H2,1-6H3 |
| InChIKey | MYJQNJGUBDKBMQ-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.22 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|