C64H123NO7 — CID 177137480
2-[butyl(methyl)amino]ethanol;[7-(formyloxymethyl)-3,7-dimethyl-1-(3-nonyldodecanoyloxymethyl)-3-bicyclo[3.3.1]nonanyl]methyl 3-nonyldodecanoate (PubChem CID 177137480) has the molecular formula C64H123NO7 and a molecular weight of 1018.69 g/mol. Its IUPAC name is 2-[butyl(methyl)amino]ethanol;[7-(formyloxymethyl)-3,7-dimethyl-1-(3-nonyldodecanoyloxymethyl)-3-bicyclo[3.3.1]nonanyl]methyl 3-nonyldodecanoate.
| Compound Name | 2-[butyl(methyl)amino]ethanol;[7-(formyloxymethyl)-3,7-dimethyl-1-(3-nonyldodecanoyloxymethyl)-3-bicyclo[3.3.1]nonanyl]methyl 3-nonyldodecanoate |
|---|---|
| PubChem CID | 177137480 |
| Molecular Formula | C64H123NO7 |
| Molecular Weight | 1018.69 g/mol |
| Exact Mass | 1017.93 |
| IUPAC Name | 2-[butyl(methyl)amino]ethanol;[7-(formyloxymethyl)-3,7-dimethyl-1-(3-nonyldodecanoyloxymethyl)-3-bicyclo[3.3.1]nonanyl]methyl 3-nonyldodecanoate |
| SMILES | CCCCCCCCCC(CCCCCCCCC)CC(=O)OCC1(C)CC2CC(C)(COC=O)CC(COC(=O)CC(CCCCCCCCC)CCCCCCCCC)(C2)C1.CCCCN(C)CCO |
| InChI | InChI=1S/C57H106O6.C7H17NO/c1-7-11-15-19-23-27-31-35-50(36-32-28-24-20-16-12-8-2)39-53(59)62-47-56(6)42-52-41-55(5,46-61-49-58)44-57(43-52,45-56)48-63-54(60)40-51(37-33-29-25-21-17-13-9-3)38-34-30-26-22-18-14-10-4;1-3-4-5-8(2)6-7-9/h49-52H,7-48H2,1-6H3;9H,3-7H2,1-2H3 |
| InChIKey | UHCTXXPGCONPQV-UHFFFAOYSA-N |
| XLogP | 18.12 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.69 |
| LogP ≤ 5 | 18.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|