C57H104F2O6 — CID 177137597
[1-[(2-fluoro-3-nonyldodecanoyl)oxymethyl]-7-(formyloxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methyl 2-fluoro-3-nonyldodecanoate (PubChem CID 177137597) has the molecular formula C57H104F2O6 and a molecular weight of 923.45 g/mol. Its IUPAC name is [1-[(2-fluoro-3-nonyldodecanoyl)oxymethyl]-7-(formyloxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methyl 2-fluoro-3-nonyldodecanoate.
| Compound Name | [1-[(2-fluoro-3-nonyldodecanoyl)oxymethyl]-7-(formyloxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methyl 2-fluoro-3-nonyldodecanoate |
|---|---|
| PubChem CID | 177137597 |
| Molecular Formula | C57H104F2O6 |
| Molecular Weight | 923.45 g/mol |
| Exact Mass | 922.78 |
| IUPAC Name | [1-[(2-fluoro-3-nonyldodecanoyl)oxymethyl]-7-(formyloxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methyl 2-fluoro-3-nonyldodecanoate |
| SMILES | CCCCCCCCCC(CCCCCCCCC)C(F)C(=O)OCC1(C)CC2CC(C)(COC=O)CC(COC(=O)C(F)C(CCCCCCCCC)CCCCCCCCC)(C2)C1 |
| InChI | InChI=1S/C57H104F2O6/c1-7-11-15-19-23-27-31-35-49(36-32-28-24-20-16-12-8-2)51(58)53(61)64-45-56(6)40-48-39-55(5,44-63-47-60)42-57(41-48,43-56)46-65-54(62)52(59)50(37-33-29-25-21-17-13-9-3)38-34-30-26-22-18-14-10-4/h47-52H,7-46H2,1-6H3 |
| InChIKey | LXOLRNMLYHHYHJ-UHFFFAOYSA-N |
| XLogP | 17.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.45 |
| LogP ≤ 5 | 17.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|