C28H48F2O4 — CID 56616838
[4-[4-[(2R)-2-fluorooctanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluorooctanoate (PubChem CID 56616838) has the molecular formula C28H48F2O4 and a molecular weight of 486.68 g/mol. Its IUPAC name is [4-[4-[(2R)-2-fluorooctanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluorooctanoate.
| Compound Name | [4-[4-[(2R)-2-fluorooctanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluorooctanoate |
|---|---|
| PubChem CID | 56616838 |
| Molecular Formula | C28H48F2O4 |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | [4-[4-[(2R)-2-fluorooctanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluorooctanoate |
| SMILES | CCCCCC[C@@H](F)C(=O)OC1CCC(C2CCC(OC(=O)[C@H](F)CCCCCC)CC2)CC1 |
| InChI | InChI=1S/C28H48F2O4/c1-3-5-7-9-11-25(29)27(31)33-23-17-13-21(14-18-23)22-15-19-24(20-16-22)34-28(32)26(30)12-10-8-6-4-2/h21-26H,3-20H2,1-2H3/t21?,22?,23?,24?,25-,26-/m1/s1 |
| InChIKey | KWMIKXUWAZNORW-ZVNFBYTRSA-N |
| XLogP | 7.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|